C23H17FN2O3S — CID 22524938
(NE)-4-fluoro-N-[3-(3-methylanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide (PubChem CID 22524938) has the molecular formula C23H17FN2O3S and a molecular weight of 420.47 g/mol. Its IUPAC name is (NE)-4-fluoro-N-[3-(3-methylanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | (NE)-4-fluoro-N-[3-(3-methylanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 22524938 |
| Molecular Formula | C23H17FN2O3S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (NE)-4-fluoro-N-[3-(3-methylanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide |
| SMILES | Cc1cccc(NC2=C/C(=N\S(=O)(=O)c3ccc(F)cc3)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H17FN2O3S/c1-15-5-4-6-17(13-15)25-22-14-21(19-7-2-3-8-20(19)23(22)27)26-30(28,29)18-11-9-16(24)10-12-18/h2-14,25H,1H3/b26-21+ |
| InChIKey | MBCFJODJZRCWMS-YYADALCUSA-N |
| XLogP | 4.50 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|