C23H16Cl2N2O3S — CID 992594
N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]-4-methylbenzenesulfonamide (PubChem CID 992594) has the molecular formula C23H16Cl2N2O3S and a molecular weight of 471.37 g/mol. Its IUPAC name is N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 992594 |
| Molecular Formula | C23H16Cl2N2O3S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C=C(Nc3cc(Cl)ccc3Cl)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H16Cl2N2O3S/c1-14-6-9-16(10-7-14)31(29,30)27-20-13-22(23(28)18-5-3-2-4-17(18)20)26-21-12-15(24)8-11-19(21)25/h2-13,26H,1H3 |
| InChIKey | CSPUQCZFJXWDCF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|