C22H14Cl2N2O3S — CID 40910726
N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide (PubChem CID 40910726) has the molecular formula C22H14Cl2N2O3S and a molecular weight of 457.34 g/mol. Its IUPAC name is N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 40910726 |
| Molecular Formula | C22H14Cl2N2O3S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | N-[3-(2,5-dichloroanilino)-4-oxonaphthalen-1-ylidene]benzenesulfonamide |
| SMILES | O=C1C(Nc2cc(Cl)ccc2Cl)=CC(=NS(=O)(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H14Cl2N2O3S/c23-14-10-11-18(24)20(12-14)25-21-13-19(16-8-4-5-9-17(16)22(21)27)26-30(28,29)15-6-2-1-3-7-15/h1-13,25H |
| InChIKey | MDAOHNFOIRNJJZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|