C20H18BrNO3S — CID 40910756
N-(3-bromo-4-oxonaphthalen-1-ylidene)-4-tert-butylbenzenesulfonamide (PubChem CID 40910756) has the molecular formula C20H18BrNO3S and a molecular weight of 432.34 g/mol. Its IUPAC name is N-(3-bromo-4-oxonaphthalen-1-ylidene)-4-tert-butylbenzenesulfonamide.
| Compound Name | N-(3-bromo-4-oxonaphthalen-1-ylidene)-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 40910756 |
| Molecular Formula | C20H18BrNO3S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-(3-bromo-4-oxonaphthalen-1-ylidene)-4-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N=C2C=C(Br)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H18BrNO3S/c1-20(2,3)13-8-10-14(11-9-13)26(24,25)22-18-12-17(21)19(23)16-7-5-4-6-15(16)18/h4-12H,1-3H3 |
| InChIKey | UAQZTFNHYKADTI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|