C24H19BrN2O6S2 — CID 21236165
(NE)-N-[(4E)-3-bromo-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide (PubChem CID 21236165) has the molecular formula C24H19BrN2O6S2 and a molecular weight of 575.46 g/mol. Its IUPAC name is (NE)-N-[(4E)-3-bromo-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide.
| Compound Name | (NE)-N-[(4E)-3-bromo-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 21236165 |
| Molecular Formula | C24H19BrN2O6S2 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | (NE)-N-[(4E)-3-bromo-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C2\C=C(Br)/C(=N/S(=O)(=O)c3ccc(OC)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H19BrN2O6S2/c1-32-16-7-11-18(12-8-16)34(28,29)26-23-15-22(25)24(21-6-4-3-5-20(21)23)27-35(30,31)19-13-9-17(33-2)10-14-19/h3-15H,1-2H3/b26-23+,27-24+ |
| InChIKey | IOZPFGJQOQUXIQ-LSBUKLHESA-N |
| XLogP | 4.35 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|