C27H19NO5S — CID 146210091
(NZ)-N-[3-(2-hydroxynaphthalen-1-yl)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide (PubChem CID 146210091) has the molecular formula C27H19NO5S and a molecular weight of 469.52 g/mol. Its IUPAC name is (NZ)-N-[3-(2-hydroxynaphthalen-1-yl)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-[3-(2-hydroxynaphthalen-1-yl)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 146210091 |
| Molecular Formula | C27H19NO5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (NZ)-N-[3-(2-hydroxynaphthalen-1-yl)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C2/C=C(c3c(O)ccc4ccccc34)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H19NO5S/c1-33-18-11-13-19(14-12-18)34(31,32)28-24-16-23(27(30)22-9-5-4-8-21(22)24)26-20-7-3-2-6-17(20)10-15-25(26)29/h2-16,29H,1H3/b28-24- |
| InChIKey | LWJJMTUHISVBMS-COOPMVRXSA-N |
| XLogP | 5.01 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|