C20H17ClN2O6S2 — CID 5440988
(NZ)-N-[(4Z)-3-chloro-4-(4-methoxyphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methoxybenzenesulfonamide (PubChem CID 5440988) has the molecular formula C20H17ClN2O6S2 and a molecular weight of 480.95 g/mol. Its IUPAC name is (NZ)-N-[(4Z)-3-chloro-4-(4-methoxyphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-[(4Z)-3-chloro-4-(4-methoxyphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 5440988 |
| Molecular Formula | C20H17ClN2O6S2 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | (NZ)-N-[(4Z)-3-chloro-4-(4-methoxyphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C2/C=C/C(=N/S(=O)(=O)c3ccc(OC)cc3)C(Cl)=C2)cc1 |
| InChI | InChI=1S/C20H17ClN2O6S2/c1-28-15-4-8-17(9-5-15)30(24,25)22-14-3-12-20(19(21)13-14)23-31(26,27)18-10-6-16(29-2)7-11-18/h3-13H,1-2H3/b22-14-,23-20- |
| InChIKey | AYAUNIJXPVMOMX-JEKQIYOESA-N |
| XLogP | 3.36 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|