C16H15Cl2NO3S — CID 171341883
4-tert-butyl-N-(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide (PubChem CID 171341883) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is 4-tert-butyl-N-(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 171341883 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 4-tert-butyl-N-(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N=C2C=C(Cl)C(=O)C(Cl)=C2)cc1 |
| InChI | InChI=1S/C16H15Cl2NO3S/c1-16(2,3)10-4-6-12(7-5-10)23(21,22)19-11-8-13(17)15(20)14(18)9-11/h4-9H,1-3H3 |
| InChIKey | NIKRWELKXKXTKS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|