C12H5BrCl3NO3S — CID 21238287
(NE)-4-bromo-N-(2,3,5-trichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide (PubChem CID 21238287) has the molecular formula C12H5BrCl3NO3S and a molecular weight of 429.51 g/mol. Its IUPAC name is (NE)-4-bromo-N-(2,3,5-trichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide.
| Compound Name | (NE)-4-bromo-N-(2,3,5-trichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 21238287 |
| Molecular Formula | C12H5BrCl3NO3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 426.82 |
| IUPAC Name | (NE)-4-bromo-N-(2,3,5-trichloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
| SMILES | O=C1C(Cl)=C/C(=N\S(=O)(=O)c2ccc(Br)cc2)C(Cl)=C1Cl |
| InChI | InChI=1S/C12H5BrCl3NO3S/c13-6-1-3-7(4-2-6)21(19,20)17-9-5-8(14)12(18)11(16)10(9)15/h1-5H/b17-9+ |
| InChIKey | CPVTYCHKPBBKPA-RQZCQDPDSA-N |
| XLogP | 3.97 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|