C19H8Br2Cl4N2O3S — CID 134937039
4-bromo-N'-(4-bromophenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide (PubChem CID 134937039) has the molecular formula C19H8Br2Cl4N2O3S and a molecular weight of 645.97 g/mol. Its IUPAC name is 4-bromo-N'-(4-bromophenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide.
| Compound Name | 4-bromo-N'-(4-bromophenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 134937039 |
| Molecular Formula | C19H8Br2Cl4N2O3S |
| Molecular Weight | 645.97 g/mol |
| Exact Mass | 641.74 |
| IUPAC Name | 4-bromo-N'-(4-bromophenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide |
| SMILES | O=C1C(Cl)=C(Cl)C(=N/C(=N/S(=O)(=O)c2ccc(Br)cc2)c2ccc(Br)cc2)C(Cl)=C1Cl |
| InChI | InChI=1S/C19H8Br2Cl4N2O3S/c20-10-3-1-9(2-4-10)19(27-31(29,30)12-7-5-11(21)6-8-12)26-17-13(22)15(24)18(28)16(25)14(17)23/h1-8H/b27-19+ |
| InChIKey | PZOODTAAPLUCHR-ZXVVBBHZSA-N |
| XLogP | 6.75 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.97 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|