About 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide
4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide (PubChem CID 15325025) has the molecular formula C12H9BrINO2S
and a molecular weight of 438.08 g/mol. Its IUPAC name is 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide |
| PubChem CID | 15325025 |
| Molecular Formula | C12H9BrINO2S |
| Molecular Weight | 438.08 g/mol |
| Exact Mass | 436.86 |
| IUPAC Name | 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide |
| SMILES | O=S(=O)(/N=I/c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H9BrINO2S/c13-10-6-8-12(9-7-10)18(16,17)15-14-11-4-2-1-3-5-11/h1-9H |
| InChIKey | CRPQIQZWJQVCEG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.08 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide?
The IUPAC name of 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide (CID 15325025) is 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide.
What is the SMILES notation for 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide?
The canonical SMILES for 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide is O=S(=O)(/N=I/c1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide?
The InChIKey is CRPQIQZWJQVCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrINO2S/c13-10-6-8-12(9-7-10)18(16,17)15-14-11-4-2-1-3-5-11/h1-9H.
What are the key properties of 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide?
4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide has a molecular weight of 438.08 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(phenyl-λ3-iodanylidene)benzenesulfonamide is sourced from PubChem (CID 15325025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).