About CID 12648432
CID 12648432 (PubChem CID 12648432) has the molecular formula C13H12BrNO2SSe
and a molecular weight of 405.18 g/mol.
Molecular Properties
| Compound Name | CID 12648432 |
| PubChem CID | 12648432 |
| Molecular Formula | C13H12BrNO2SSe |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 404.89 |
| IUPAC Name | — |
| SMILES | C/[Se](=N\S(=O)(=O)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H12BrNO2SSe/c1-19(13-9-7-11(14)8-10-13)15-18(16,17)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | RVRQJMOGFUATND-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12648432 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12648432?
The IUPAC name of CID 12648432 (CID 12648432) is not available.
What is the SMILES notation for CID 12648432?
The canonical SMILES for CID 12648432 is C/[Se](=N\S(=O)(=O)c1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of CID 12648432?
The InChIKey is RVRQJMOGFUATND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNO2SSe/c1-19(13-9-7-11(14)8-10-13)15-18(16,17)12-5-3-2-4-6-12/h2-10H,1H3.
What are the key properties of CID 12648432?
CID 12648432 has a molecular weight of 405.18 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12648432 is sourced from PubChem (CID 12648432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).