C19H15BrFNO3S2 — CID 98085804
N-[[(S)-(4-bromophenyl)-fluoromethyl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 98085804) has the molecular formula C19H15BrFNO3S2 and a molecular weight of 468.37 g/mol. Its IUPAC name is N-[[(S)-(4-bromophenyl)-fluoromethyl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | N-[[(S)-(4-bromophenyl)-fluoromethyl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 98085804 |
| Molecular Formula | C19H15BrFNO3S2 |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | N-[[(S)-(4-bromophenyl)-fluoromethyl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | O=S(=O)(N=[S@](=O)(c1ccccc1)[C@H](F)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H15BrFNO3S2/c20-16-13-11-15(12-14-16)19(21)26(23,17-7-3-1-4-8-17)22-27(24,25)18-9-5-2-6-10-18/h1-14,19H/t19-,26-/m0/s1 |
| InChIKey | GXZXKVBTTPNYCL-SIBVEZHUSA-N |
| XLogP | 5.33 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |