C14H11BrCl2O3S — CID 2333012
[(1S)-1-(4-bromophenyl)-2,2-dichloroethyl] benzenesulfonate (PubChem CID 2333012) has the molecular formula C14H11BrCl2O3S and a molecular weight of 410.12 g/mol. Its IUPAC name is [(1S)-1-(4-bromophenyl)-2,2-dichloroethyl] benzenesulfonate.
| Compound Name | [(1S)-1-(4-bromophenyl)-2,2-dichloroethyl] benzenesulfonate |
|---|---|
| PubChem CID | 2333012 |
| Molecular Formula | C14H11BrCl2O3S |
| Molecular Weight | 410.12 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | [(1S)-1-(4-bromophenyl)-2,2-dichloroethyl] benzenesulfonate |
| SMILES | O=S(=O)(O[C@@H](c1ccc(Br)cc1)C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11BrCl2O3S/c15-11-8-6-10(7-9-11)13(14(16)17)20-21(18,19)12-4-2-1-3-5-12/h1-9,13-14H/t13-/m0/s1 |
| InChIKey | DFVJWHYMWZVZAM-ZDUSSCGKSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.12 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|