C19H14BrIN2O2S — CID 46368553
N'-(4-bromophenyl)sulfonyl-N-(2-iodophenyl)benzenecarboximidamide (PubChem CID 46368553) has the molecular formula C19H14BrIN2O2S and a molecular weight of 541.21 g/mol. Its IUPAC name is N'-(4-bromophenyl)sulfonyl-N-(2-iodophenyl)benzenecarboximidamide.
| Compound Name | N'-(4-bromophenyl)sulfonyl-N-(2-iodophenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 46368553 |
| Molecular Formula | C19H14BrIN2O2S |
| Molecular Weight | 541.21 g/mol |
| Exact Mass | 539.90 |
| IUPAC Name | N'-(4-bromophenyl)sulfonyl-N-(2-iodophenyl)benzenecarboximidamide |
| SMILES | O=S(=O)(/N=C(\Nc1ccccc1I)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14BrIN2O2S/c20-15-10-12-16(13-11-15)26(24,25)23-19(14-6-2-1-3-7-14)22-18-9-5-4-8-17(18)21/h1-13H,(H,22,23) |
| InChIKey | KVFQXYIUUALHNR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|