C20H20BrN3O3S — CID 3641637
N'-(4-bromophenyl)sulfonyl-N-(5-tert-butyl-1,2-oxazol-3-yl)benzenecarboximidamide (PubChem CID 3641637) has the molecular formula C20H20BrN3O3S and a molecular weight of 462.37 g/mol. Its IUPAC name is N'-(4-bromophenyl)sulfonyl-N-(5-tert-butyl-1,2-oxazol-3-yl)benzenecarboximidamide.
| Compound Name | N'-(4-bromophenyl)sulfonyl-N-(5-tert-butyl-1,2-oxazol-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 3641637 |
| Molecular Formula | C20H20BrN3O3S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N'-(4-bromophenyl)sulfonyl-N-(5-tert-butyl-1,2-oxazol-3-yl)benzenecarboximidamide |
| SMILES | CC(C)(C)c1cc(NC(=NS(=O)(=O)c2ccc(Br)cc2)c2ccccc2)no1 |
| InChI | InChI=1S/C20H20BrN3O3S/c1-20(2,3)17-13-18(23-27-17)22-19(14-7-5-4-6-8-14)24-28(25,26)16-11-9-15(21)10-12-16/h4-13H,1-3H3,(H,22,23,24) |
| InChIKey | CVJJJFWQCYWZAI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|