C18H14N2O5S2 — CID 134936394
N-[(6Z)-6-(benzenesulfonylimino)-3-oxocyclohexa-1,4-dien-1-yl]benzenesulfonamide (PubChem CID 134936394) has the molecular formula C18H14N2O5S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[(6Z)-6-(benzenesulfonylimino)-3-oxocyclohexa-1,4-dien-1-yl]benzenesulfonamide.
| Compound Name | N-[(6Z)-6-(benzenesulfonylimino)-3-oxocyclohexa-1,4-dien-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134936394 |
| Molecular Formula | C18H14N2O5S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | N-[(6Z)-6-(benzenesulfonylimino)-3-oxocyclohexa-1,4-dien-1-yl]benzenesulfonamide |
| SMILES | O=C1C=C/C(=N/S(=O)(=O)c2ccccc2)C(NS(=O)(=O)c2ccccc2)=C1 |
| InChI | InChI=1S/C18H14N2O5S2/c21-14-11-12-17(19-26(22,23)15-7-3-1-4-8-15)18(13-14)20-27(24,25)16-9-5-2-6-10-16/h1-13,20H/b19-17- |
| InChIKey | GWHDZGXPMDTFDZ-ZPHPHTNESA-N |
| XLogP | 1.82 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|