C18H13NO5S2 — CID 3400368
N-[3-(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide (PubChem CID 3400368) has the molecular formula C18H13NO5S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 3400368 |
| Molecular Formula | C18H13NO5S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-[3-(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide |
| SMILES | O=C1C=CC(=NS(=O)(=O)c2ccccc2)C=C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H13NO5S2/c20-17-12-11-14(19-26(23,24)16-9-5-2-6-10-16)13-18(17)25(21,22)15-7-3-1-4-8-15/h1-13H |
| InChIKey | IPEVSNHUFKXCJK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|