C19H15NO4S — CID 6536819
(NZ)-N-(4-oxo-3-phenylmethoxycyclohexa-2,5-dien-1-ylidene)benzenesulfonamide (PubChem CID 6536819) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is (NZ)-N-(4-oxo-3-phenylmethoxycyclohexa-2,5-dien-1-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-N-(4-oxo-3-phenylmethoxycyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 6536819 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (NZ)-N-(4-oxo-3-phenylmethoxycyclohexa-2,5-dien-1-ylidene)benzenesulfonamide |
| SMILES | O=C1C=C/C(=N/S(=O)(=O)c2ccccc2)C=C1OCc1ccccc1 |
| InChI | InChI=1S/C19H15NO4S/c21-18-12-11-16(20-25(22,23)17-9-5-2-6-10-17)13-19(18)24-14-15-7-3-1-4-8-15/h1-13H,14H2/b20-16- |
| InChIKey | OOPYBYSFLZUMBK-SILNSSARSA-N |
| XLogP | 3.06 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|