C16H10BrNO3S — CID 6508042
(NE)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)naphthalene-2-sulfonamide (PubChem CID 6508042) has the molecular formula C16H10BrNO3S and a molecular weight of 376.23 g/mol. Its IUPAC name is (NE)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)naphthalene-2-sulfonamide.
| Compound Name | (NE)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 6508042 |
| Molecular Formula | C16H10BrNO3S |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | (NE)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)naphthalene-2-sulfonamide |
| SMILES | O=C1C=C/C(=N\S(=O)(=O)c2ccc3ccccc3c2)C=C1Br |
| InChI | InChI=1S/C16H10BrNO3S/c17-15-10-13(6-8-16(15)19)18-22(20,21)14-7-5-11-3-1-2-4-12(11)9-14/h1-10H/b18-13+ |
| InChIKey | HYLBFUABCAYBAC-QGOAFFKASA-N |
| XLogP | 3.39 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|