C20H17BrN2O4S2 — CID 23661773
(NE)-N-[(4E)-3-bromo-4-(4-methylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide (PubChem CID 23661773) has the molecular formula C20H17BrN2O4S2 and a molecular weight of 493.40 g/mol. Its IUPAC name is (NE)-N-[(4E)-3-bromo-4-(4-methylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[(4E)-3-bromo-4-(4-methylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23661773 |
| Molecular Formula | C20H17BrN2O4S2 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | (NE)-N-[(4E)-3-bromo-4-(4-methylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\C=C/C(=N\S(=O)(=O)c3ccc(C)cc3)C(Br)=C2)cc1 |
| InChI | InChI=1S/C20H17BrN2O4S2/c1-14-3-8-17(9-4-14)28(24,25)22-16-7-12-20(19(21)13-16)23-29(26,27)18-10-5-15(2)6-11-18/h3-13H,1-2H3/b22-16+,23-20+ |
| InChIKey | QBBSJEATCDJGCJ-VVJAPSPLSA-N |
| XLogP | 4.11 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|