About Dispersing Agent NNO
Dispersing Agent NNO (PubChem CID 156594502) has the molecular formula C11H10NaO4S
and a molecular weight of 261.25 g/mol.
Molecular Properties
| Compound Name | Dispersing Agent NNO |
| PubChem CID | 156594502 |
| Molecular Formula | C11H10NaO4S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | — |
| SMILES | C=O.O=S(=O)(O)c1ccc2ccccc2c1.[Na] |
| InChI | InChI=1S/C10H8O3S.CH2O.Na/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;1-2;/h1-7H,(H,11,12,13);1H2; |
| InChIKey | IWQLXFICQJMUGN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze Dispersing Agent NNO with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dispersing Agent NNO?
The IUPAC name of Dispersing Agent NNO (CID 156594502) is not available.
What is the SMILES notation for Dispersing Agent NNO?
The canonical SMILES for Dispersing Agent NNO is C=O.O=S(=O)(O)c1ccc2ccccc2c1.[Na].
What is the InChIKey of Dispersing Agent NNO?
The InChIKey is IWQLXFICQJMUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S.CH2O.Na/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;1-2;/h1-7H,(H,11,12,13);1H2;.
What are the key properties of Dispersing Agent NNO?
Dispersing Agent NNO has a molecular weight of 261.25 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Dispersing Agent NNO is sourced from PubChem (CID 156594502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).