About 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene
3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene (PubChem CID 19956540) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene |
| PubChem CID | 19956540 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene |
| SMILES | COC1=CC(C)CC(C)=C1C |
| InChI | InChI=1S/C10H16O/c1-7-5-8(2)9(3)10(6-7)11-4/h6-7H,5H2,1-4H3 |
| InChIKey | KSGJAXHFHOJCBJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene?
The IUPAC name of 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene (CID 19956540) is 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene.
What is the SMILES notation for 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene?
The canonical SMILES for 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene is COC1=CC(C)CC(C)=C1C.
What is the InChIKey of 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene?
The InChIKey is KSGJAXHFHOJCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-7-5-8(2)9(3)10(6-7)11-4/h6-7H,5H2,1-4H3.
What are the key properties of 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene?
3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene has a molecular weight of 152.24 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1,2,5-trimethylcyclohexa-1,3-diene is sourced from PubChem (CID 19956540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).