C12H17NO — CID 156873053
N-(6-methoxy-2,4-dimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine (PubChem CID 156873053) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-(6-methoxy-2,4-dimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine.
| Compound Name | N-(6-methoxy-2,4-dimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 156873053 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-(6-methoxy-2,4-dimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C1=C(C)CC(C)C=C1OC |
| InChI | InChI=1S/C12H17NO/c1-5-6-13-12-10(3)7-9(2)8-11(12)14-4/h5-6,8-9H,1,7H2,2-4H3/b13-6+ |
| InChIKey | SCCWFXSJSMJECO-AWNIVKPZSA-N |
| XLogP | 3.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|