C10H14Cl2O2 — CID 22015914
5,6-dichloro-3,6-dimethoxy-1,2-dimethylcyclohexa-1,3-diene (PubChem CID 22015914) has the molecular formula C10H14Cl2O2 and a molecular weight of 237.13 g/mol. Its IUPAC name is 5,6-dichloro-3,6-dimethoxy-1,2-dimethylcyclohexa-1,3-diene.
| Compound Name | 5,6-dichloro-3,6-dimethoxy-1,2-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22015914 |
| Molecular Formula | C10H14Cl2O2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 5,6-dichloro-3,6-dimethoxy-1,2-dimethylcyclohexa-1,3-diene |
| SMILES | COC1=CC(Cl)C(Cl)(OC)C(C)=C1C |
| InChI | InChI=1S/C10H14Cl2O2/c1-6-7(2)10(12,14-4)9(11)5-8(6)13-3/h5,9H,1-4H3 |
| InChIKey | BWIMQWSYVOXCIZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|