C12H20N2O — CID 143188882
1-(6-methoxy-4-methylcyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 143188882) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(6-methoxy-4-methylcyclohexa-1,5-dien-1-yl)piperazine.
| Compound Name | 1-(6-methoxy-4-methylcyclohexa-1,5-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 143188882 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(6-methoxy-4-methylcyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | COC1=CC(C)CC=C1N1CCNCC1 |
| InChI | InChI=1S/C12H20N2O/c1-10-3-4-11(12(9-10)15-2)14-7-5-13-6-8-14/h4,9-10,13H,3,5-8H2,1-2H3 |
| InChIKey | ISFFFGBMBLJQLV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |