About 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine
1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine (PubChem CID 144516697) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine.
Molecular Properties
| Compound Name | 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine |
| PubChem CID | 144516697 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine |
| SMILES | COCCOCOC1=CCCC=C1N1CCNCC1 |
| InChI | InChI=1S/C14H24N2O3/c1-17-10-11-18-12-19-14-5-3-2-4-13(14)16-8-6-15-7-9-16/h4-5,15H,2-3,6-12H2,1H3 |
| InChIKey | OSPBMMBPSICNPK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine?
The IUPAC name of 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine (CID 144516697) is 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine.
What is the SMILES notation for 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine?
The canonical SMILES for 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine is COCCOCOC1=CCCC=C1N1CCNCC1.
What is the InChIKey of 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine?
The InChIKey is OSPBMMBPSICNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-17-10-11-18-12-19-14-5-3-2-4-13(14)16-8-6-15-7-9-16/h4-5,15H,2-3,6-12H2,1H3.
What are the key properties of 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine?
1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine has a molecular weight of 268.36 g/mol, XLogP of 1.09, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-methoxyethoxymethoxy)cyclohexa-1,5-dien-1-yl]piperazine is sourced from PubChem (CID 144516697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).