C13H20N2O2 — CID 65364808
1-[4-(methoxymethoxy)phenyl]-1,4-diazepane (PubChem CID 65364808) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[4-(methoxymethoxy)phenyl]-1,4-diazepane.
| Compound Name | 1-[4-(methoxymethoxy)phenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 65364808 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-[4-(methoxymethoxy)phenyl]-1,4-diazepane |
| SMILES | COCOc1ccc(N2CCCNCC2)cc1 |
| InChI | InChI=1S/C13H20N2O2/c1-16-11-17-13-5-3-12(4-6-13)15-9-2-7-14-8-10-15/h3-6,14H,2,7-11H2,1H3 |
| InChIKey | XJBRGLDIMVXYBM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|