C14H19F3N2O2 — CID 106705834
1-[3-(2,2,2-trifluoroethoxymethoxy)phenyl]-1,4-diazepane (PubChem CID 106705834) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxymethoxy)phenyl]-1,4-diazepane.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxymethoxy)phenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 106705834 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxymethoxy)phenyl]-1,4-diazepane |
| SMILES | FC(F)(F)COCOc1cccc(N2CCCNCC2)c1 |
| InChI | InChI=1S/C14H19F3N2O2/c15-14(16,17)10-20-11-21-13-4-1-3-12(9-13)19-7-2-5-18-6-8-19/h1,3-4,9,18H,2,5-8,10-11H2 |
| InChIKey | BFZSGULIHDEYQM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|