C14H20ClF3N2O — CID 143061676
1-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]piperazine;ethane (PubChem CID 143061676) has the molecular formula C14H20ClF3N2O and a molecular weight of 324.77 g/mol. Its IUPAC name is 1-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]piperazine;ethane.
| Compound Name | 1-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]piperazine;ethane |
|---|---|
| PubChem CID | 143061676 |
| Molecular Formula | C14H20ClF3N2O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]piperazine;ethane |
| SMILES | CC.FC(F)(F)COc1cc(N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O.C2H6/c13-10-2-1-9(18-5-3-17-4-6-18)7-11(10)19-8-12(14,15)16;1-2/h1-2,7,17H,3-6,8H2;1-2H3 |
| InChIKey | DTQXPSMYJQIAEE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |