C14H19F3N2O — CID 64565536
1-[4-(3,3,3-trifluoropropoxy)phenyl]-1,4-diazepane (PubChem CID 64565536) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[4-(3,3,3-trifluoropropoxy)phenyl]-1,4-diazepane.
| Compound Name | 1-[4-(3,3,3-trifluoropropoxy)phenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 64565536 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[4-(3,3,3-trifluoropropoxy)phenyl]-1,4-diazepane |
| SMILES | FC(F)(F)CCOc1ccc(N2CCCNCC2)cc1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)6-11-20-13-4-2-12(3-5-13)19-9-1-7-18-8-10-19/h2-5,18H,1,6-11H2 |
| InChIKey | WAVJFAHBVLHKHS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|