C11H15NO5 — CID 129029052
methyl (5S)-4-(1-hydroxyethyl)-6-methyl-5-nitrocyclohexa-1,3-diene-1-carboxylate (PubChem CID 129029052) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is methyl (5S)-4-(1-hydroxyethyl)-6-methyl-5-nitrocyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl (5S)-4-(1-hydroxyethyl)-6-methyl-5-nitrocyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 129029052 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | methyl (5S)-4-(1-hydroxyethyl)-6-methyl-5-nitrocyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C(C(C)O)[C@@H]([N+](=O)[O-])C1C |
| InChI | InChI=1S/C11H15NO5/c1-6-8(11(14)17-3)4-5-9(7(2)13)10(6)12(15)16/h4-7,10,13H,1-3H3/t6?,7?,10-/m0/s1 |
| InChIKey | WIOGNRVJZPEVOU-QIMWKCOFSA-N |
| XLogP | 0.69 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|