methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate

C13H14O3 — CID 10560758

IUPACmethyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate
SMILESCOC(=O)C1=C[C@@H](c2ccccc2)O[C@H]1C
InChIInChI=1S/C13H14O3/c1-9-11(13(14)15-2)8-12(16-9)10-6-4-3-5-7-10/h3-9,12H,1-2H3/t9-,12-/m0/s1
InChIKeyMECKXYMWZFOIRJ-CABZTGNLSA-N
MW218.25 g/mol
LogP2.25
Rot. Bonds2

About methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate

methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate (PubChem CID 10560758) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate.

Molecular Properties

Compound Namemethyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate
PubChem CID10560758
Molecular FormulaC13H14O3
Molecular Weight218.25 g/mol
Exact Mass218.09
IUPAC Namemethyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate
SMILESCOC(=O)C1=C[C@@H](c2ccccc2)O[C@H]1C
InChIInChI=1S/C13H14O3/c1-9-11(13(14)15-2)8-12(16-9)10-6-4-3-5-7-10/h3-9,12H,1-2H3/t9-,12-/m0/s1
InChIKeyMECKXYMWZFOIRJ-CABZTGNLSA-N
XLogP2.25
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 52.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate?
The IUPAC name of methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate (CID 10560758) is methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate.
What is the SMILES notation for methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate?
The canonical SMILES for methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate is COC(=O)C1=C[C@@H](c2ccccc2)O[C@H]1C.
What is the InChIKey of methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate?
The InChIKey is MECKXYMWZFOIRJ-CABZTGNLSA-N. The full InChI is InChI=1S/C13H14O3/c1-9-11(13(14)15-2)8-12(16-9)10-6-4-3-5-7-10/h3-9,12H,1-2H3/t9-,12-/m0/s1.
What are the key properties of methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate?
methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate has a molecular weight of 218.25 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,5S)-2-methyl-5-phenyl-2,5-dihydrofuran-3-carboxylate is sourced from PubChem (CID 10560758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).