C14H16O3 — CID 142911838
methyl 2,2-dimethyl-3-phenyl-3H-furan-4-carboxylate (PubChem CID 142911838) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-phenyl-3H-furan-4-carboxylate.
| Compound Name | methyl 2,2-dimethyl-3-phenyl-3H-furan-4-carboxylate |
|---|---|
| PubChem CID | 142911838 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl 2,2-dimethyl-3-phenyl-3H-furan-4-carboxylate |
| SMILES | COC(=O)C1=COC(C)(C)C1c1ccccc1 |
| InChI | InChI=1S/C14H16O3/c1-14(2)12(10-7-5-4-6-8-10)11(9-17-14)13(15)16-3/h4-9,12H,1-3H3 |
| InChIKey | XAYQDIKPVICHFS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |