C34H34N2O10 — CID 10532059
tetramethyl (6S,12R)-3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate (PubChem CID 10532059) has the molecular formula C34H34N2O10 and a molecular weight of 630.65 g/mol. Its IUPAC name is tetramethyl (6S,12R)-3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate.
| Compound Name | tetramethyl (6S,12R)-3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate |
|---|---|
| PubChem CID | 10532059 |
| Molecular Formula | C34H34N2O10 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | tetramethyl (6S,12R)-3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate |
| SMILES | COC(=O)C1=CN(C(C)=O)C2C(C(=O)OC)(C3N(C(C)=O)C=C(C(=O)OC)[C@H](c4ccccc4)C23C(=O)OC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H34N2O10/c1-19(37)35-17-23(27(39)43-3)25(21-13-9-7-10-14-21)33(31(41)45-5)29(35)34(32(42)46-6)26(22-15-11-8-12-16-22)24(28(40)44-4)18-36(20(2)38)30(33)34/h7-18,25-26,29-30H,1-6H3/t25-,26+,29?,30?,33?,34? |
| InChIKey | KSBJJBCXNXNKKH-GHWWVECRSA-N |
| XLogP | 2.46 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|