C44H46N2O8 — CID 10876346
dimethyl (6R,12S)-3,9-dibenzyl-1,7-bis(hydroxymethyl)-6,12-bis(4-methoxyphenyl)-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-5,11-dicarboxylate (PubChem CID 10876346) has the molecular formula C44H46N2O8 and a molecular weight of 730.86 g/mol. Its IUPAC name is dimethyl (6R,12S)-3,9-dibenzyl-1,7-bis(hydroxymethyl)-6,12-bis(4-methoxyphenyl)-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-5,11-dicarboxylate.
| Compound Name | dimethyl (6R,12S)-3,9-dibenzyl-1,7-bis(hydroxymethyl)-6,12-bis(4-methoxyphenyl)-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-5,11-dicarboxylate |
|---|---|
| PubChem CID | 10876346 |
| Molecular Formula | C44H46N2O8 |
| Molecular Weight | 730.86 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | dimethyl (6R,12S)-3,9-dibenzyl-1,7-bis(hydroxymethyl)-6,12-bis(4-methoxyphenyl)-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-5,11-dicarboxylate |
| SMILES | COC(=O)C1=CN(Cc2ccccc2)C2C(CO)(C3N(Cc4ccccc4)C=C(C(=O)OC)[C@@H](c4ccc(OC)cc4)C23CO)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C44H46N2O8/c1-51-33-19-15-31(16-20-33)37-35(39(49)53-3)25-45(23-29-11-7-5-8-12-29)41-43(37,27-47)42-44(41,28-48)38(32-17-21-34(52-2)22-18-32)36(40(50)54-4)26-46(42)24-30-13-9-6-10-14-30/h5-22,25-26,37-38,41-42,47-48H,23-24,27-28H2,1-4H3/t37-,38+,41?,42?,43?,44? |
| InChIKey | CHPJMELPULNQCV-PVDPDNOQSA-N |
| XLogP | 5.42 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.86 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |