C32H34N2O6 — CID 101169334
diethyl 3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,7-dicarboxylate (PubChem CID 101169334) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is diethyl 3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,7-dicarboxylate.
| Compound Name | diethyl 3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,7-dicarboxylate |
|---|---|
| PubChem CID | 101169334 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | diethyl 3,9-diacetyl-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,7-dicarboxylate |
| SMILES | CCOC(=O)C12C(c3ccccc3)C=CN(C(C)=O)C1C1(C(=O)OCC)C(c3ccccc3)C=CN(C(C)=O)C21 |
| InChI | InChI=1S/C32H34N2O6/c1-5-39-29(37)31-25(23-13-9-7-10-14-23)17-19-33(21(3)35)27(31)32(30(38)40-6-2)26(24-15-11-8-12-16-24)18-20-34(22(4)36)28(31)32/h7-20,25-28H,5-6H2,1-4H3 |
| InChIKey | WAAFZJATUTVJTP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |