C31H30O5 — CID 40929952
trans-ethyl (3S,5S)-1-acetyl-3,5-dibenzoyl-4-phenylcyclohexane-1-carboxylate (PubChem CID 40929952) has the molecular formula C31H30O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is trans-ethyl (3S,5S)-1-acetyl-3,5-dibenzoyl-4-phenylcyclohexane-1-carboxylate.
| Compound Name | trans-ethyl (3S,5S)-1-acetyl-3,5-dibenzoyl-4-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 40929952 |
| Molecular Formula | C31H30O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | trans-ethyl (3S,5S)-1-acetyl-3,5-dibenzoyl-4-phenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)C[C@H](C(=O)c2ccccc2)C(c2ccccc2)[C@@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C31H30O5/c1-3-36-30(35)31(21(2)32)19-25(28(33)23-15-9-5-10-16-23)27(22-13-7-4-8-14-22)26(20-31)29(34)24-17-11-6-12-18-24/h4-18,25-27H,3,19-20H2,1-2H3/t25-,26-,27?,31?/m0/s1 |
| InChIKey | OIVHDHPDELZIRH-OCYYLPOSSA-N |
| XLogP | 5.70 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|