C21H24O3 — CID 86055270
(2,2-diethoxy-4-phenylcyclobutyl)-phenylmethanone (PubChem CID 86055270) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2,2-diethoxy-4-phenylcyclobutyl)-phenylmethanone.
| Compound Name | (2,2-diethoxy-4-phenylcyclobutyl)-phenylmethanone |
|---|---|
| PubChem CID | 86055270 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (2,2-diethoxy-4-phenylcyclobutyl)-phenylmethanone |
| SMILES | CCOC1(OCC)CC(c2ccccc2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O3/c1-3-23-21(24-4-2)15-18(16-11-7-5-8-12-16)19(21)20(22)17-13-9-6-10-14-17/h5-14,18-19H,3-4,15H2,1-2H3 |
| InChIKey | FRBJMCCDBPZXJH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|