C22H21ClO5 — CID 101491951
trans-diethyl (2R,3S)-2-benzoyl-3-(4-chlorophenyl)cyclopropane-1,1-dicarboxylate (PubChem CID 101491951) has the molecular formula C22H21ClO5 and a molecular weight of 400.86 g/mol. Its IUPAC name is trans-diethyl (2R,3S)-2-benzoyl-3-(4-chlorophenyl)cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2R,3S)-2-benzoyl-3-(4-chlorophenyl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101491951 |
| Molecular Formula | C22H21ClO5 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | trans-diethyl (2R,3S)-2-benzoyl-3-(4-chlorophenyl)cyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](C(=O)c2ccccc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClO5/c1-3-27-20(25)22(21(26)28-4-2)17(14-10-12-16(23)13-11-14)18(22)19(24)15-8-6-5-7-9-15/h5-13,17-18H,3-4H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | RXFDQWDTSGAUMG-MSOLQXFVSA-N |
| XLogP | 4.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|