C29H27BrO6 — CID 50942380
diethyl (2R,4S,5R)-4-benzoyl-2-(4-bromophenyl)-5-phenyloxolane-3,3-dicarboxylate (PubChem CID 50942380) has the molecular formula C29H27BrO6 and a molecular weight of 551.43 g/mol. Its IUPAC name is diethyl (2R,4S,5R)-4-benzoyl-2-(4-bromophenyl)-5-phenyloxolane-3,3-dicarboxylate.
| Compound Name | diethyl (2R,4S,5R)-4-benzoyl-2-(4-bromophenyl)-5-phenyloxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 50942380 |
| Molecular Formula | C29H27BrO6 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | diethyl (2R,4S,5R)-4-benzoyl-2-(4-bromophenyl)-5-phenyloxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccc(Br)cc2)O[C@@H](c2ccccc2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27BrO6/c1-3-34-27(32)29(28(33)35-4-2)23(24(31)19-11-7-5-8-12-19)25(20-13-9-6-10-14-20)36-26(29)21-15-17-22(30)18-16-21/h5-18,23,25-26H,3-4H2,1-2H3/t23-,25+,26-/m1/s1 |
| InChIKey | MIBZVDUFKWNXLB-DMTNHVFBSA-N |
| XLogP | 5.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|