C30H30O7 — CID 50942472
diethyl (2R,4S,5R)-4-(4-methoxybenzoyl)-2,5-diphenyloxolane-3,3-dicarboxylate (PubChem CID 50942472) has the molecular formula C30H30O7 and a molecular weight of 502.56 g/mol. Its IUPAC name is diethyl (2R,4S,5R)-4-(4-methoxybenzoyl)-2,5-diphenyloxolane-3,3-dicarboxylate.
| Compound Name | diethyl (2R,4S,5R)-4-(4-methoxybenzoyl)-2,5-diphenyloxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 50942472 |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | diethyl (2R,4S,5R)-4-(4-methoxybenzoyl)-2,5-diphenyloxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccccc2)O[C@@H](c2ccccc2)[C@H]1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H30O7/c1-4-35-28(32)30(29(33)36-5-2)24(25(31)20-16-18-23(34-3)19-17-20)26(21-12-8-6-9-13-21)37-27(30)22-14-10-7-11-15-22/h6-19,24,26-27H,4-5H2,1-3H3/t24-,26+,27-/m1/s1 |
| InChIKey | ZGMFVGQHHHCOQY-FXVJXKIMSA-N |
| XLogP | 5.12 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|