C17H13NO3 — CID 51031994
(2R,3S)-2-(4-methoxybenzoyl)-3-phenyloxirane-2-carbonitrile (PubChem CID 51031994) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2R,3S)-2-(4-methoxybenzoyl)-3-phenyloxirane-2-carbonitrile.
| Compound Name | (2R,3S)-2-(4-methoxybenzoyl)-3-phenyloxirane-2-carbonitrile |
|---|---|
| PubChem CID | 51031994 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2R,3S)-2-(4-methoxybenzoyl)-3-phenyloxirane-2-carbonitrile |
| SMILES | COc1ccc(C(=O)[C@]2(C#N)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13NO3/c1-20-14-9-7-12(8-10-14)15(19)17(11-18)16(21-17)13-5-3-2-4-6-13/h2-10,16H,1H3/t16-,17-/m0/s1 |
| InChIKey | KOLCZKHBNNJPLQ-IRXDYDNUSA-N |
| XLogP | 2.91 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|