C11H10N2O2 — CID 100975708
methyl (2S,3R)-2-cyano-3-phenyloxirane-2-carboximidate (PubChem CID 100975708) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl (2S,3R)-2-cyano-3-phenyloxirane-2-carboximidate.
| Compound Name | methyl (2S,3R)-2-cyano-3-phenyloxirane-2-carboximidate |
|---|---|
| PubChem CID | 100975708 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | methyl (2S,3R)-2-cyano-3-phenyloxirane-2-carboximidate |
| SMILES | [H]/N=C(\OC)[C@@]1(C#N)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H10N2O2/c1-14-10(13)11(7-12)9(15-11)8-5-3-2-4-6-8/h2-6,9,13H,1H3/b13-10-/t9-,11+/m1/s1 |
| InChIKey | AKHXXQGCIWTODK-GIWCNJTOSA-N |
| XLogP | 1.64 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|