C22H16N4O2 — CID 98131433
(1S,4R,5S,7R)-3-imino-1-methyl-5,7-diphenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 98131433) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is (1S,4R,5S,7R)-3-imino-1-methyl-5,7-diphenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | (1S,4R,5S,7R)-3-imino-1-methyl-5,7-diphenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 98131433 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (1S,4R,5S,7R)-3-imino-1-methyl-5,7-diphenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]2(C)O[C@@H](c3ccccc3)[C@]1(C#N)C(C#N)(C#N)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C22H16N4O2/c1-20-17(15-8-4-2-5-9-15)21(12-23,13-24)22(14-25,19(26)28-20)18(27-20)16-10-6-3-7-11-16/h2-11,17-18,26H,1H3/b26-19-/t17-,18-,20-,22-/m0/s1 |
| InChIKey | MYHXPTPDSAEKDZ-WRSZCOSLSA-N |
| XLogP | 3.81 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|