C20H18N4O2 — CID 3813724
13-imino-10-phenyl-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile (PubChem CID 3813724) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 13-imino-10-phenyl-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile.
| Compound Name | 13-imino-10-phenyl-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
|---|---|
| PubChem CID | 3813724 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 13-imino-10-phenyl-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCCC2C1(C#N)C(C#N)(C#N)C(c1ccccc1)O3 |
| InChI | InChI=1S/C20H18N4O2/c21-11-18(12-22)16(14-7-3-1-4-8-14)25-20-10-6-2-5-9-15(20)19(18,13-23)17(24)26-20/h1,3-4,7-8,15-16,24H,2,5-6,9-10H2/b24-17+ |
| InChIKey | DSWYUGSSEJEZIF-JJIBRWJFSA-N |
| XLogP | 3.59 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|