C12H11ClN4O3 — CID 177388326
methyl N-[(Z)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate (PubChem CID 177388326) has the molecular formula C12H11ClN4O3 and a molecular weight of 294.70 g/mol. Its IUPAC name is methyl N-[(Z)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate.
| Compound Name | methyl N-[(Z)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate |
|---|---|
| PubChem CID | 177388326 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | methyl N-[(Z)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate |
| SMILES | COC(=O)N/N=C(\N)[C@@]1(C#N)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN4O3/c1-19-11(18)17-16-10(15)12(6-14)9(20-12)7-2-4-8(13)5-3-7/h2-5,9H,1H3,(H2,15,16)(H,17,18)/t9-,12+/m1/s1 |
| InChIKey | DCUSIFKSPOQNBZ-SKDRFNHKSA-N |
| XLogP | 1.30 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|