C12H12N2O2 — CID 15416202
methyl (2R,3R)-2-cyano-3-(4-methylphenyl)oxirane-2-carboximidate (PubChem CID 15416202) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl (2R,3R)-2-cyano-3-(4-methylphenyl)oxirane-2-carboximidate.
| Compound Name | methyl (2R,3R)-2-cyano-3-(4-methylphenyl)oxirane-2-carboximidate |
|---|---|
| PubChem CID | 15416202 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | methyl (2R,3R)-2-cyano-3-(4-methylphenyl)oxirane-2-carboximidate |
| SMILES | [H]/N=C(\OC)[C@]1(C#N)O[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C12H12N2O2/c1-8-3-5-9(6-4-8)10-12(7-13,16-10)11(14)15-2/h3-6,10,14H,1-2H3/b14-11-/t10-,12-/m1/s1 |
| InChIKey | MSEJZTKXOYGRML-ANHQAILBSA-N |
| XLogP | 1.95 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|