C19H18N4O3 — CID 15506731
benzyl N-[(Z)-[amino-[(2R,3R)-2-cyano-3-(4-methylphenyl)oxiran-2-yl]methylidene]amino]carbamate (PubChem CID 15506731) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is benzyl N-[(Z)-[amino-[(2R,3R)-2-cyano-3-(4-methylphenyl)oxiran-2-yl]methylidene]amino]carbamate.
| Compound Name | benzyl N-[(Z)-[amino-[(2R,3R)-2-cyano-3-(4-methylphenyl)oxiran-2-yl]methylidene]amino]carbamate |
|---|---|
| PubChem CID | 15506731 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | benzyl N-[(Z)-[amino-[(2R,3R)-2-cyano-3-(4-methylphenyl)oxiran-2-yl]methylidene]amino]carbamate |
| SMILES | Cc1ccc([C@H]2O[C@]2(C#N)/C(N)=N/NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4O3/c1-13-7-9-15(10-8-13)16-19(12-20,26-16)17(21)22-23-18(24)25-11-14-5-3-2-4-6-14/h2-10,16H,11H2,1H3,(H2,21,22)(H,23,24)/t16-,19+/m1/s1 |
| InChIKey | ODSNATGLLMWIRF-APWZRJJASA-N |
| XLogP | 2.53 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|