C11H14N4O3S — CID 86755687
benzyl N-[[[amino(methylsulfanyl)methylidene]amino]carbamoyl]carbamate (PubChem CID 86755687) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is benzyl N-[[[amino(methylsulfanyl)methylidene]amino]carbamoyl]carbamate.
| Compound Name | benzyl N-[[[amino(methylsulfanyl)methylidene]amino]carbamoyl]carbamate |
|---|---|
| PubChem CID | 86755687 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | benzyl N-[[[amino(methylsulfanyl)methylidene]amino]carbamoyl]carbamate |
| SMILES | CSC(N)=NNC(=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H14N4O3S/c1-19-9(12)14-15-10(16)13-11(17)18-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,12,14)(H2,13,15,16,17) |
| InChIKey | QYUZZVFTYVMMJY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|